Molecular Structure:
CAS No.:
210487-06-2
Product Name.:
CCD No.:CCD00100228
Formula:C22 D12
MolWeight:288.41
![INDENO[1,2,3-CD]FLUORANTHENE-D12 Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(6)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | INDENO[1,2,3-CD]FLUORANTHENE-D12 |
| CAS： | 210487-06-2 |
| English Synonyms： | INDENO[1,2,3-CD]FLUORANTHENE-D12 |
| MDL Number.： | MFCD00215973 |
| H bond acceptor： | 0 |
| H bond donor： | 0 |
| Smile： | [2H]c1c(c(c-2c(c1[2H])-c3c(c(c-4c5c3c2c(c(c5-c6c4c(c(c(c6[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
| InChiKey： | InChIKey=null |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
