* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (R)-(-)-2-(-1-METHYLHYDRAZINO)BUTAN-1-OL |
CAS: | 211987-91-6 |
English Synonyms: | (R)-(-)-2-(-1-METHYLHYDRAZINO)BUTAN-1-OL |
MDL Number.: | MFCD16876632 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CC[C@H](CO)N(C)N |
InChi: | InChI=1S/C5H14N2O/c1-3-5(4-8)7(2)6/h5,8H,3-4,6H2,1-2H3/t5-/m1/s1 |
InChiKey: | InChIKey=BLPWTTGUWAXVJG-RXMQYKEDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.