* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-BUTEN-2-ONE, 4-(METHYLAMINO)-3-NITRO-, (3Z)- |
CAS: | 213619-75-1 |
English Synonyms: | 3-BUTEN-2-ONE, 4-(METHYLAMINO)-3-NITRO-, (3Z)- |
MDL Number.: | MFCD18829420 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CC(=O)/C(=C/NC)/[N+](=O)[O-] |
InChi: | InChI=1S/C5H8N2O3/c1-4(8)5(3-6-2)7(9)10/h3,6H,1-2H3/b5-3- |
InChiKey: | InChIKey=UPEVPQDBJVDBIA-HYXAFXHYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.