* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,2,3,4-TETRAMETHOXYBENZENE |
CAS: | 21450-56-6 |
English Synonyms: | BENZENE, 1,2,3,4-TETRAMETHOXY- ; 1,2,3,4-TETRAMETHOXYBENZENE |
MDL Number.: | MFCD00068614 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | COc1ccc(c(c1OC)OC)OC |
InChi: | InChI=1S/C10H14O4/c1-11-7-5-6-8(12-2)10(14-4)9(7)13-3/h5-6H,1-4H3 |
InChiKey: | InChIKey=QCNHIJXDZKTWSA-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.