* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-Piperidinone, 1-(2-ethoxyethyl)- |
CAS: | 215228-85-6 |
English Synonyms: | 4-PIPERIDINONE, 1-(2-ETHOXYETHYL)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(C)OCCN1CCC(CC1)=O |
InChi: | InChI=1S/C9H17NO2/c1-2-12-8-7-10-5-3-9(11)4-6-10/h2-8H2,1H3 |
InChiKey: | InChIKey=FUJINXDLPBSOGS-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.