* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (3S,4R)-4-BENZYLPYRROLIDIN-3-OL |
CAS: | 215922-83-1 |
English Synonyms: | (3S,4R)-4-BENZYLPYRROLIDIN-3-OL |
MDL Number.: | MFCD17011747 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | c1ccc(cc1)C[C@@H]2CNC[C@H]2O |
InChi: | InChI=1S/C11H15NO/c13-11-8-12-7-10(11)6-9-4-2-1-3-5-9/h1-5,10-13H,6-8H2/t10-,11-/m1/s1 |
InChiKey: | InChIKey=XOLLUCNYIRMTHL-GHMZBOCLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.