Molecular Structure:
CAS No.:
21675-61-6
;78333-15-0
Product Name.:
CCD No.:CCD00052295
Formula:C6 H6 N O2 T7
MolWeight:145.23
![LEUCINE,L,[4,5-3H(N)] Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(7)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(2)
|
|
| Product Name： | LEUCINE,L,[4,5-3H(N)] |
| CAS： | 21675-61-6 ;78333-15-0 |
| English Synonyms： | LEUCINE,L,[4,5-3H(N)] ; L-LEUCINE-[4,5-3H(N)] ; L-LEUCINE-[3,4,5-3H(N)] |
| MDL Number.： | MFCD00083396 |
| H bond acceptor： | 3 |
| H bond donor： | 2 |
| Smile： | [3H]C([3H])([3H])C([3H])(C[C@@H](C(=O)O)N)C([3H])([3H])[3H] |
| InChiKey： | InChIKey=null |
|
|
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
