* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VAT ORANGE 11 |
| CAS: | 2172-33-0 |
| English Synonyms: | CI VAT ORANGE 11 ; VAT ORANGE 11 |
| MDL Number.: | MFCD09838807 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | c1ccc2c(c1)c(=O)c3ccc4c5ccc6c(c5[nH]c4c3c2=O)c(=O)c7ccc8c9ccc1c(c9[nH]c8c7c6=O)c(=O)c2ccccc2c1=O |
| InChi: | InChI=1S/C42H18N2O6/c45-37-21-5-1-3-7-23(21)39(47)29-25(37)13-9-17-19-11-15-27-31(35(19)43-33(17)29)41(49)28-16-12-20-18-10-14-26-30(34(18)44-36(20)32(28)42(27)50)40(48)24-8-4-2-6-22(24)38(26)46/h1-16,43-44H |
| InChiKey: | InChIKey=CVWSULASWLZVCH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.