Molecular Structure:
CAS No.:
217487-47-3
Product Name.:
CCD No.:CCD00058743
Formula:C16 H14 F N3 O S
MolWeight:315.371
![4-[2-[4-(4-FLUOROPHENYL)-5-MERCAPTO-4H-1,2,4-TRIAZOL-3-YL]ETHYL]PHENOL Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(9)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(2)
|
|
| Product Name： | 4-[2-[4-(4-FLUOROPHENYL)-5-MERCAPTO-4H-1,2,4-TRIAZOL-3-YL]ETHYL]PHENOL |
| CAS： | 217487-47-3 |
| English Synonyms： | 4-[2-[4-(4-FLUOROPHENYL)-5-MERCAPTO-4H-1,2,4-TRIAZOL-3-YL]ETHYL]PHENOL |
| MDL Number.： | MFCD00115623 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | c1cc(ccc1CCc2nnc(n2c3ccc(cc3)F)S)O |
| InChi： | InChI=1S/C16H14FN3OS/c17-12-4-6-13(7-5-12)20-15(18-19-16(20)22)10-3-11-1-8-14(21)9-2-11/h1-2,4-9,21H,3,10H2,(H,19,22) |
| InChiKey： | InChIKey=CAQNCYJKSKYPSA-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
