Molecular Structure:
CAS No.:
218600-48-7
Product Name.:
CCD No.:CCD00783075
Formula:C31 H45 N O3
MolWeight:479.701
![OLEANA-2,12-DIENO[2,3-D]ISOXAZOL-28-OIC ACID Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(14)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(3)
|
|
| Product Name： | OLEANA-2,12-DIENO[2,3-D]ISOXAZOL-28-OIC ACID |
| CAS： | 218600-48-7 |
| English Synonyms： | OLEANA-2,12-DIENO[2,3-D]ISOXAZOL-28-OIC ACID |
| MDL Number.： | MFCD09752459 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | CC1(CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(Cc6cnoc6C5(C)C)C)C)[C@@H]2C1)C)C(=O)O)C |
| InChi： | InChI=1S/C31H45NO3/c1-26(2)12-14-31(25(33)34)15-13-29(6)20(21(31)17-26)8-9-23-28(5)16-19-18-32-35-24(19)27(3,4)22(28)10-11-30(23,29)7/h8,18,21-23H,9-17H2,1-7H3,(H,33,34)/t21-,22-,23+,28-,29+,30+,31-/m0/s1 |
| InChiKey： | InChIKey=KAVKWHJDPYCYQA-VNNAKPRGSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
