* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,6-DIMETHOXYBENZAMIDE |
CAS: | 21864-67-5 |
English Synonyms: | 2,6-DIMETHOXYBENZAMIDE |
MDL Number.: | MFCD00828821 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | COc1cccc(c1C(=O)N)OC |
InChi: | InChI=1S/C9H11NO3/c1-12-6-4-3-5-7(13-2)8(6)9(10)11/h3-5H,1-2H3,(H2,10,11) |
InChiKey: | InChIKey=ZAUCRONGJXRQRD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.