* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3,5-DIAMINO-2,6-DIMETHYLBENZOIC ACID |
| CAS: | 219297-24-2 |
| English Synonyms: | 3,5-DIAMINO-2,6-DIMETHYLBENZOIC ACID |
| MDL Number.: | MFCD01076304 |
| H bond acceptor: | 4 |
| H bond donor: | 3 |
| Smile: | Cc1c(cc(c(c1C(=O)O)C)N)N |
| InChi: | InChI=1S/C9H12N2O2/c1-4-6(10)3-7(11)5(2)8(4)9(12)13/h3H,10-11H2,1-2H3,(H,12,13) |
| InChiKey: | InChIKey=BIKOQOQJOSLXSQ-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.