* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2H-AZEPIN-7-AMINE, 3,4,5,6-TETRAHYDRO-3,3-DIMETHYL- |
| CAS: | 219477-70-0 |
| English Synonyms: | 3,4,5,6-TETRAHYDRO-3,3-DIMETHYL-2H-AZEPIN-7-AMINE ; 2H-AZEPIN-7-AMINE, 3,4,5,6-TETRAHYDRO-3,3-DIMETHYL- |
| MDL Number.: | MFCD18814391 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CC1(CCCC(=NC1)N)C |
| InChi: | InChI=1S/C8H16N2/c1-8(2)5-3-4-7(9)10-6-8/h3-6H2,1-2H3,(H2,9,10) |
| InChiKey: | InChIKey=WOIIKMVKEOGGOM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.