* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZILANTEL |
| CAS: | 22012-72-2 |
| English Synonyms: | ZILANTEL |
| MDL Number.: | MFCD00864545 |
| H bond acceptor: | 8 |
| H bond donor: | 0 |
| Smile: | CCOP(=O)(/N=C(\SCCS/C(=N/P(=O)(OCC)OCC)/SCc1ccccc1)/SCc2ccccc2)OCC |
| InChi: | InChI=1S/C26H38N2O6P2S4/c1-5-31-35(29,32-6-2)27-25(39-21-23-15-11-9-12-16-23)37-19-20-38-26(28-36(30,33-7-3)34-8-4)40-22-24-17-13-10-14-18-24/h9-18H,5-8,19-22H2,1-4H3/b27-25-,28-26+ |
| InChiKey: | InChIKey=CZPAAISSUBSIDF-ZQZMJUSDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.