* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 5-NITRO-2-PENTANONE |
CAS: | 22020-87-7 |
English Synonyms: | 5-NITROPENTAN-2-ONE ; 5-NITRO-2-PENTANONE |
MDL Number.: | MFCD00128798 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CC(=O)CCC[N+](=O)[O-] |
InChi: | InChI=1S/C5H9NO3/c1-5(7)3-2-4-6(8)9/h2-4H2,1H3 |
InChiKey: | InChIKey=MBFOTTCUUAIBDW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.