* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PYRROLIDINE, 1-(BROMOACETYL)-2-ETHENYL-, (2S)- |
| CAS: | 220319-76-6 |
| English Synonyms: | PYRROLIDINE, 1-(BROMOACETYL)-2-ETHENYL-, (2S)- |
| MDL Number.: | MFCD13173374 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | C=C[C@@H]1CCCN1C(=O)CBr |
| InChi: | InChI=1S/C8H12BrNO/c1-2-7-4-3-5-10(7)8(11)6-9/h2,7H,1,3-6H2/t7-/m1/s1 |
| InChiKey: | InChIKey=DWMKJIMNALVIGX-SSDOTTSWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.