* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Benzenamine, 4-methyl-3-(2,2,2-trifluoroethoxy)- |
CAS: | 220996-42-9 |
English Synonyms: | BENZENAMINE, 4-METHYL-3-(2,2,2-TRIFLUOROETHOXY)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CC1=C(C=C(C=C1)N)OCC(F)(F)F |
InChi: | InChI=1S/C9H10F3NO/c1-6-2-3-7(13)4-8(6)14-5-9(10,11)12/h2-4H,5,13H2,1H3 |
InChiKey: | InChIKey=PUUWPAZAVMKTHC-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.