* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(CHLOROMETHYL)-1,4-DIOXASPIRO[4.4]NONANE |
CAS: | 22195-53-5 |
English Synonyms: | 2-(CHLOROMETHYL)-1,4-DIOXASPIRO[4.4]NONANE |
MDL Number.: | MFCD02975829 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | C1CCC2(C1)OCC(O2)CCl |
InChi: | InChI=1S/C8H13ClO2/c9-5-7-6-10-8(11-7)3-1-2-4-8/h7H,1-6H2 |
InChiKey: | InChIKey=YIFKYXFYLABVBB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.