* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BICYCLO[2.2.2]OCT-5-EN-2-ONE |
CAS: | 2220-40-8 |
English Synonyms: | BICYCLO[2.2.2]OCT-2-EN-5-ONE ; BICYCLO[2.2.2]OCT-5-EN-2-ONE |
MDL Number.: | MFCD12828876 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | C1C[C@H]2C=C[C@@H]1CC2=O |
InChi: | InChI=1S/C8H10O/c9-8-5-6-1-3-7(8)4-2-6/h1,3,6-7H,2,4-5H2/t6-,7+/m0/s1 |
InChiKey: | InChIKey=UJVGEBBKXJLFPB-NKWVEPMBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.