* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3,4,5,6-TETRAHYDROBENZO[B]AZOCIN-2(1H)-ONE |
| CAS: | 22246-75-9 |
| English Synonyms: | 1,2,3,4,5,6-HEXAHYDRO-1-BENZAZOCIN-2-ONE ; 3,4,5,6-TETRAHYDROBENZO[B]AZOCIN-2(1H)-ONE |
| MDL Number.: | MFCD00024152 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | c1ccc2c(c1)CCCCC(=O)N2 |
| InChi: | InChI=1S/C11H13NO/c13-11-8-4-2-6-9-5-1-3-7-10(9)12-11/h1,3,5,7H,2,4,6,8H2,(H,12,13) |
| InChiKey: | InChIKey=LROOVTDSEGKMHC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.