* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | BORNELONE |
CAS: | 2226-11-1 |
English Synonyms: | BORNELONE |
MDL Number.: | MFCD00868208 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | CC(=O)/C=C/C=C\1/C2CCC(C2)C1(C)C |
InChi: | InChI=1S/C14H20O/c1-10(15)5-4-6-13-11-7-8-12(9-11)14(13,2)3/h4-6,11-12H,7-9H2,1-3H3/b5-4+,13-6- |
InChiKey: | InChIKey=WDMFHQNUSVLQMS-XFYQWYMDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.