* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (S)-1-BROMO-3-METHYLPENTANE |
CAS: | 22299-70-3 |
English Synonyms: | (3S)-1-BROMO-3-METHYLPENTANE ; (S)-1-BROMO-3-METHYLPENTANE |
MDL Number.: | MFCD02262160 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CC[C@H](C)CCBr |
InChi: | InChI=1S/C6H13Br/c1-3-6(2)4-5-7/h6H,3-5H2,1-2H3/t6-/m0/s1 |
InChiKey: | InChIKey=MDCCBJLCTOTLKM-LURJTMIESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.