* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PYRROLO[1,2-C]PYRIMIDIN-1(2H)-ONE |
CAS: | 223432-96-0 |
English Synonyms: | PYRROLO[1,2-C]PYRIMIDIN-1(2H)-ONE |
MDL Number.: | MFCD12923542 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cc2cc[nH]c(=O)n2c1 |
InChi: | InChI=1S/C7H6N2O/c10-7-8-4-3-6-2-1-5-9(6)7/h1-5H,(H,8,10) |
InChiKey: | InChIKey=BQTWGGGLMLASSY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.