* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ATAGABALIN |
CAS: | 223445-75-8 |
English Synonyms: | ATAGABALIN |
MDL Number.: | MFCD19443719 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | C[C@H]1CC(C[C@@H]1C)(CC(=O)O)CN |
InChi: | InChI=1S/C10H19NO2/c1-7-3-10(6-11,4-8(7)2)5-9(12)13/h7-8H,3-6,11H2,1-2H3,(H,12,13)/t7-,8-/m0/s1 |
InChiKey: | InChIKey=IUVMAUQEZFTTFB-YUMQZZPRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.