* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | NEPINALONE |
CAS: | 22443-11-4 |
English Synonyms: | NEPINALONE |
MDL Number.: | MFCD00866846 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CC1(c2ccccc2CCC1=O)CCN3CCCCC3 |
InChi: | InChI=1S/C18H25NO/c1-18(11-14-19-12-5-2-6-13-19)16-8-4-3-7-15(16)9-10-17(18)20/h3-4,7-8H,2,5-6,9-14H2,1H3 |
InChiKey: | InChIKey=RVXGRCNWGOHSDE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.