* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PSEUDOVARDENAFIL |
| CAS: | 224788-34-5 |
| English Synonyms: | PSEUDOVARDENAFIL |
| MDL Number.: | MFCD09752153 |
| H bond acceptor: | 9 |
| H bond donor: | 1 |
| Smile: | CCCc1nc(c2n1[nH]c(nc2=O)c3cc(ccc3OCC)S(=O)(=O)N4CCCCC4)C |
| InChi: | InChI=1S/C22H29N5O4S/c1-4-9-19-23-15(3)20-22(28)24-21(25-27(19)20)17-14-16(10-11-18(17)31-5-2)32(29,30)26-12-7-6-8-13-26/h10-11,14H,4-9,12-13H2,1-3H3,(H,24,25,28) |
| InChiKey: | InChIKey=QAYHPAMSDMZXJB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.