* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7H-BENZO[C]PHENOTHIAZINE |
| CAS: | 226-06-2 |
| English Synonyms: | 7H-BENZO[C]PHENOTHIAZINE |
| MDL Number.: | MFCD00156585 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | c1ccc2c(c1)ccc3c2Sc4ccccc4N3 |
| InChi: | InChI=1S/C16H11NS/c1-2-6-12-11(5-1)9-10-14-16(12)18-15-8-4-3-7-13(15)17-14/h1-10,17H |
| InChiKey: | InChIKey=WUTNPRKQMZJXTR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.