* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1,1,3,3-TETRABROMOACETONE |
| CAS: | 22612-89-1 |
| English Synonyms: | 1,1,3,3-TETRABROMOPROPAN-2-ONE ; 1,1,3,3-TETRABROMO-2-PROPANONE ; 1,1,3,3-TETRABROMOACETONE |
| MDL Number.: | MFCD00059470 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | C(C(=O)C(Br)Br)(Br)Br |
| InChi: | InChI=1S/C3H2Br4O/c4-2(5)1(8)3(6)7/h2-3H |
| InChiKey: | InChIKey=SAMNBOHOBWEEEU-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.