* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ENDO-BREVICOMIN |
CAS: | 22625-19-0 |
English Synonyms: | ENDO-BREVICOMIN |
MDL Number.: | MFCD00797950 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CC[C@H]1[C@H]2CCC[C@](O2)(O1)C |
InChi: | InChI=1S/C9H16O2/c1-3-7-8-5-4-6-9(2,10-7)11-8/h7-8H,3-6H2,1-2H3/t7-,8+,9-/m0/s1 |
InChiKey: | InChIKey=YONXEBYXWVCXIV-YIZRAAEISA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.