* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | L-PROLINE, 5-(4-METHYLPHENYL)-, ETHYL ESTER, (5S)- |
| CAS: | 226973-88-2 |
| EnglishSynonyms: | L-PROLINE, 5-(4-METHYLPHENYL)-, ETHYL ESTER, (5S)- |
| pro_mdlNumber: | MFCD15071971 |
| pro_acceptors: | 3 |
| pro_donors: | 1 |
| pro_smile: | CCOC(=O)[C@@H]1CC[C@H](N1)c2ccc(cc2)C |
| InChi: | InChI=1S/C14H19NO2/c1-3-17-14(16)13-9-8-12(15-13)11-6-4-10(2)5-7-11/h4-7,12-13,15H,3,8-9H2,1-2H3/t12-,13-/m0/s1 |
| InChiKey: | InChIKey=SMUGUNFHUFWAIU-STQMWFEESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.