* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-FORMYLINDOLO[3,2-B]CARBAZOLE |
CAS: | 229020-82-0 ;172922-91-7 |
English Synonyms: | 6-FORMYLINDOLO[3,2-B]CARBAZOLE |
MDL Number.: | MFCD02684034 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | c1ccc2=Nc3c(=c2c1)cc-4c(=Nc5c4cccc5)c3C=O |
InChi: | InChI=1S/C19H10N2O/c22-10-15-18-13(11-5-1-3-7-16(11)20-18)9-14-12-6-2-4-8-17(12)21-19(14)15/h1-10H |
InChiKey: | InChIKey=XYQROJCCYYBCKI-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.