* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-BENZYL-9-AZABICYCLO[3.3.1]NONAN-3-ONE |
CAS: | 2291-59-0 ;81879-64-3 ;2291-58-9 |
English Synonyms: | 9-BENZYL-9-AZABICYCLO[3.3.1]NONAN-3-ONE ; (1R,5S)-9-BENZYL-9-AZABICYCLO[3.3.1]NONAN-3-ONE ; 9-BENZYL-3-OXO-9-AZABICYCLO[3.3.1]NONANE |
MDL Number.: | MFCD00144851 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1ccc(cc1)CN2[C@@H]3CCC[C@H]2CC(=O)C3 |
InChi: | InChI=1S/C15H19NO/c17-15-9-13-7-4-8-14(10-15)16(13)11-12-5-2-1-3-6-12/h1-3,5-6,13-14H,4,7-11H2/t13-,14+ |
InChiKey: | InChIKey=BVEFCNSLJKPSEA-OKILXGFUSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.