* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9,9-DIETHYL-9H-FLUORENE |
CAS: | 2294-79-3 |
English Synonyms: | 9,9-DIETHYL-9H-FLUORENE |
MDL Number.: | MFCD00971284 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CCC1(c2ccccc2-c3c1cccc3)CC |
InChi: | InChI=1S/C17H18/c1-3-17(4-2)15-11-7-5-9-13(15)14-10-6-8-12-16(14)17/h5-12H,3-4H2,1-2H3 |
InChiKey: | InChIKey=DXLHOCYBTWOELM-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.