* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4H,6H-DITHIENO[3,4-C:3',4'-E]OXEPIN |
CAS: | 23062-34-2 |
English Synonyms: | 4H,6H-DITHIENO[3,4-C:3',4'-E]OXEPIN |
MDL Number.: | MFCD17012208 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | c1c2c(cs1)-c3cscc3COC2 |
InChi: | InChI=1S/C10H8OS2/c1-7-3-12-5-9(7)10-6-13-4-8(10)2-11-1/h3-6H,1-2H2 |
InChiKey: | InChIKey=LBKKXPSTOSLTSB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.