* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-(5-NITRO-2-FURYL)-2-PROPEN-1-OL |
CAS: | 69064-38-6 ;23073-95-2 |
English Synonyms: | (2E)-3-(5-NITRO-2-FURYL)PROP-2-EN-1-OL ; 3-(5-NITRO-2-FURANYL)-2-PROPEN-1-OL ; 3-(5-NITRO-2-FURYL)-2-PROPEN-1-OL |
MDL Number.: | MFCD01074878 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1cc(oc1/C=C/CO)[N+](=O)[O-] |
InChi: | InChI=1S/C7H7NO4/c9-5-1-2-6-3-4-7(12-6)8(10)11/h1-4,9H,5H2/b2-1+ |
InChiKey: | InChIKey=JZYGBCSCBHBXAA-OWOJBTEDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.