* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | XANTHINE, [8-14C] |
CAS: | 23199-23-7 |
English Synonyms: | XANTHINE, [8-14C] |
MDL Number.: | MFCD00235451 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | [14cH]1[nH]c2c(n1)[nH]c(=O)[nH]c2=O |
InChi: | InChI=1S/C5H4N4O2/c10-4-2-3(7-1-6-2)8-5(11)9-4/h1H,(H3,6,7,8,9,10,11)/i1+2 |
InChiKey: | InChIKey=LRFVTYWOQMYALW-NJFSPNSNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.