* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | (3,5,17)-17-ACETATE ANDROSTANE-3,17-DIOL |
CAS: | 2324-11-0 |
English Synonyms: | (3,5,17)-17-ACETATE ANDROSTANE-3,17-DIOL |
MDL Number.: | MFCD11618131 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC(=O)OC1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4[C@@]3(CCC(C4)O)C)C |
InChi: | InChI=1S/C21H34O3/c1-13(22)24-19-7-6-17-16-5-4-14-12-15(23)8-10-20(14,2)18(16)9-11-21(17,19)3/h14-19,23H,4-12H2,1-3H3/t14?,15?,16-,17-,18-,19?,20-,21-/m0/s1 |
InChiKey: | InChIKey=HPSZQGQRLMRJLO-ZDWXVBRDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.