* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-BROMO-3-(2-BROMOPROPYL)BENZENE |
CAS: | 23430-37-7 |
English Synonyms: | 1-BROMO-3-(2-BROMOPROPYL)BENZENE |
MDL Number.: | MFCD17274317 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CC(Cc1cccc(c1)Br)Br |
InChi: | InChI=1S/C9H10Br2/c1-7(10)5-8-3-2-4-9(11)6-8/h2-4,6-7H,5H2,1H3 |
InChiKey: | InChIKey=JMZJZQSKBJTMFX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.