* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2H-PYRROL-2-ONE, 1,5-DIHYDRO-4-HYDROXY-3-METHYL-5-(1-METHYLETHYL)-, (5S)- |
CAS: | 234752-13-7 |
English Synonyms: | 2H-PYRROL-2-ONE, 1,5-DIHYDRO-4-HYDROXY-3-METHYL-5-(1-METHYLETHYL)-, (5S)- |
MDL Number.: | MFCD18836008 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CC1=C([C@@H](NC1=O)C(C)C)O |
InChi: | InChI=1S/C8H13NO2/c1-4(2)6-7(10)5(3)8(11)9-6/h4,6,10H,1-3H3,(H,9,11)/t6-/m0/s1 |
InChiKey: | InChIKey=QIDUAFBTUMVDDC-LURJTMIESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.