* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-BENZYL-1H-INDOLE |
CAS: | 23543-62-6 |
English Synonyms: | 5-BENZYL-1H-INDOLE |
MDL Number.: | MFCD17170140 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)Cc2ccc3c(c2)cc[nH]3 |
InChi: | InChI=1S/C15H13N/c1-2-4-12(5-3-1)10-13-6-7-15-14(11-13)8-9-16-15/h1-9,11,16H,10H2 |
InChiKey: | InChIKey=RZGCPIPFXSMATQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.