* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | HINESOL |
CAS: | 23811-08-7 |
English Synonyms: | HINESOL |
MDL Number.: | MFCD00189423 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CC1CCC=C([C@]12CC[C@@H](C2)C(C)(C)O)C |
InChi: | InChI=1S/C15H26O/c1-11-6-5-7-12(2)15(11)9-8-13(10-15)14(3,4)16/h6,12-13,16H,5,7-10H2,1-4H3/t12?,13-,15+/m0/s1 |
InChiKey: | InChIKey=ICWHTQRTTHCUHW-RGPPAHDHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.