* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-HEXYL-PHENANTHRENE |
CAS: | 23921-09-7 |
English Synonyms: | 9-HEXYL-PHENANTHRENE |
MDL Number.: | MFCD00426580 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CCCCCCc1cc2ccccc2c3c1cccc3 |
InChi: | InChI=1S/C20H22/c1-2-3-4-5-10-16-15-17-11-6-7-12-18(17)20-14-9-8-13-19(16)20/h6-9,11-15H,2-5,10H2,1H3 |
InChiKey: | InChIKey=YSFSQIAXZCVLMC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.