* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | H-ALA-THR-OH |
CAS: | 24032-50-6 |
English Synonyms: | ALA-THR ; H-ALA-THR-OH |
MDL Number.: | MFCD00025551 |
H bond acceptor: | 6 |
H bond donor: | 4 |
Smile: | C[C@H]([C@@H](C(=O)O)NC(=O)[C@H](C)N)O |
InChi: | InChI=1S/C7H14N2O4/c1-3(8)6(11)9-5(4(2)10)7(12)13/h3-5,10H,8H2,1-2H3,(H,9,11)(H,12,13)/t3-,4+,5-/m0/s1 |
InChiKey: | InChIKey=BUQICHWNXBIBOG-LMVFSUKVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.