* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,5-DIPHENYL-1H-[1,2,4]TRIAZOLE-3-CARBOXYLIC ACID |
CAS: | 24058-92-2 |
English Synonyms: | LIBRARION L531 ; 1,5-DIPHENYL-1H-[1,2,4]TRIAZOLE-3-CARBOXYLIC ACID |
MDL Number.: | MFCD02679989 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)c2nc(nn2c3ccccc3)C(=O)O |
InChi: | InChI=1S/C15H11N3O2/c19-15(20)13-16-14(11-7-3-1-4-8-11)18(17-13)12-9-5-2-6-10-12/h1-10H,(H,19,20) |
InChiKey: | InChIKey=RBJKFWPNGGRTOV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.