* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-(3,4-Difluorophenyl)piperazine 2HCl |
CAS: | 241484-99-1 |
English Synonyms: | 1-(3,4-DIFLUOROPHENYL)PIPERAZINE 2HCL |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | Cl.Cl.FC=1C=C(C=CC1F)N1CCNCC1 |
InChi: | InChI=1S/C10H12F2N2.2ClH/c11-9-2-1-8(7-10(9)12)14-5-3-13-4-6-14;;/h1-2,7,13H,3-6H2;2*1H |
InChiKey: | InChIKey=HPRNKLRZVRZKMR-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.