* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-OXA-3-AZASPIRO[4.5]DECAN-2-ONE |
CAS: | 24247-68-5 ;16112-51-9 |
English Synonyms: | 1-OXA-3-AZASPIRO[4.5]DECAN-2-ONE |
MDL Number.: | MFCD17170020 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | C1CCC2(CC1)CNC(=O)O2 |
InChi: | InChI=1S/C8H13NO2/c10-7-9-6-8(11-7)4-2-1-3-5-8/h1-6H2,(H,9,10) |
InChiKey: | InChIKey=JSKHUKHPFPVCJW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.