* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | Z-HIS-LYS(BOC)-NHNH2 |
CAS: | 24252-86-6 |
English Synonyms: | Z-HIS-LYS(BOC)-NHNH2 |
MDL Number.: | MFCD00238465 |
H bond acceptor: | 13 |
H bond donor: | 6 |
Smile: | CC(C)(C)OC(=O)NCCCC[C@@H](C(=O)NN)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)OCc2ccccc2 |
InChi: | InChI=1S/C25H37N7O6/c1-25(2,3)38-23(35)28-12-8-7-11-19(22(34)32-26)30-21(33)20(13-18-14-27-16-29-18)31-24(36)37-15-17-9-5-4-6-10-17/h4-6,9-10,14,16,19-20H,7-8,11-13,15,26H2,1-3H3,(H,27,29)(H,28,35)(H,30,33)(H,31,36)(H,32,34)/t19-,20-/m0/s1 |
InChiKey: | InChIKey=WSDNILYHGWPGII-PMACEKPBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.