* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 4-(PIPERIDIN-1-YL)PHENOL |
CAS: | 24302-35-0 |
English Synonyms: | 4-(PIPERIDIN-1-YL)PHENOL |
MDL Number.: | MFCD21605358 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1cc(ccc1N2CCCCC2)O |
InChi: | InChI=1S/C11H15NO/c13-11-6-4-10(5-7-11)12-8-2-1-3-9-12/h4-7,13H,1-3,8-9H2 |
InChiKey: | InChIKey=FJTDDUIPUAXKSP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.