Molecular Structure:
CAS No.:
24313-49-3
Product Name.:
CCD No.:CCD00052872
Formula:C5 H5 D5 O
MolWeight:91.1635
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | 2-PENTANONE-1,1,1,3,3-D5 |
| CAS： | 24313-49-3 |
| English Synonyms： | 2-PENTANONE-1,1,1,3,3-D5 ; METHYL PROPYL KETONE-1,1,1,3,3-D5 ; ETHYL(ACETONE-D5) ; METHYL-D3 PROPYL-1,1-D2 KETONE |
| MDL Number.： | MFCD00084160 |
| H bond acceptor： | 1 |
| H bond donor： | 0 |
| Smile： | [2H]C([2H])([2H])C(=O)C([2H])([2H])CC |
| InChiKey： | InChIKey=null |
|
|
| Melting Point： | -78 DEG C(LIT) |
| Boiling Point： | 101-105 DEG C(LIT) |
| Density： | DENSITY: 0.855 G/ML AT 25 DEG C |
| Physical Property： | FLASHPOINT: 44.6 DEG F FLASHPOINT: 7 DEG C |
| Comments： | MASS SHIFT: M+5 RIDADR: UN 1249 3/PG 2 WGK: 1 |
| Information： | ISOTOPIC PURITY: 98 ATOM % D MW: 91.07 BY ATOM % CALCULATION |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
