* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2-BROMO-5-PHENYLPYRAZINE |
CAS: | 243472-69-7 |
English Synonyms: | 2-BROMO-5-PHENYLPYRAZINE |
MDL Number.: | MFCD11100002 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1ccc(cc1)c2cnc(cn2)Br |
InChi: | InChI=1S/C10H7BrN2/c11-10-7-12-9(6-13-10)8-4-2-1-3-5-8/h1-7H |
InChiKey: | InChIKey=SLFNGAVOQANKIE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.